C14H20ClN7 — CID 803062
2-N-(3-chloro-4-methylphenyl)-4-N,4-N-diethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine (PubChem CID 803062) has the molecular formula C14H20ClN7 and a molecular weight of 321.82 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methylphenyl)-4-N,4-N-diethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-methylphenyl)-4-N,4-N-diethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 803062 |
| Molecular Formula | C14H20ClN7 |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-N-(3-chloro-4-methylphenyl)-4-N,4-N-diethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(NN)nc(Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H20ClN7/c1-4-22(5-2)14-19-12(18-13(20-14)21-16)17-10-7-6-9(3)11(15)8-10/h6-8H,4-5,16H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | JSPHRJSYTQVGLM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|