C17H18ClNO2 — CID 803437
2-(4-chloro-2-methylphenoxy)-N-(2,6-dimethylphenyl)acetamide (PubChem CID 803437) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 803437 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H18ClNO2/c1-11-5-4-6-12(2)17(11)19-16(20)10-21-15-8-7-14(18)9-13(15)3/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | YAAOGWRNCVNBRT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |