C15H14N4OS2 — CID 804043
1-(2,1,3-benzothiadiazol-5-yl)-3-(4-ethoxyphenyl)thiourea (PubChem CID 804043) has the molecular formula C15H14N4OS2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-5-yl)-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 804043 |
| Molecular Formula | C15H14N4OS2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C15H14N4OS2/c1-2-20-12-6-3-10(4-7-12)16-15(21)17-11-5-8-13-14(9-11)19-22-18-13/h3-9H,2H2,1H3,(H2,16,17,21) |
| InChIKey | BESWLCDPXSVTTF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|