About N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide
N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide (PubChem CID 804116) has the molecular formula C12H14N4OS
and a molecular weight of 262.33 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide |
| PubChem CID | 804116 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)piperidine-1-carboxamide |
| SMILES | C1CCN(CC1)C(=O)NC2=CC3=NSN=C3C=C2 |
| InChI | InChI=1S/C12H14N4OS/c17-12(16-6-2-1-3-7-16)13-9-4-5-10-11(8-9)15-18-14-10/h4-5,8H,1-3,6-7H2,(H,13,17) |
| InChIKey | WWNHSUWRGQPVLB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 308 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide?
The IUPAC name of N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide (CID 804116) is N-(2,1,3-benzothiadiazol-5-yl)piperidine-1-carboxamide.
What is the SMILES notation for N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide?
The canonical SMILES for N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide is C1CCN(CC1)C(=O)NC2=CC3=NSN=C3C=C2.
What is the InChIKey of N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide?
The InChIKey is WWNHSUWRGQPVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS/c17-12(16-6-2-1-3-7-16)13-9-4-5-10-11(8-9)15-18-14-10/h4-5,8H,1-3,6-7H2,(H,13,17).
What are the key properties of N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide?
N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide has a molecular weight of 262.33 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-2,1,3-benzothiadiazol-5-yl-1-piperidinecarboxamide is sourced from PubChem (CID 804116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).