About N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide
N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 804168) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| PubChem CID | 804168 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15N3O2S/c1-9-12(10(2)15(3)13-9)14-18(16,17)11-7-5-4-6-8-11/h4-8,14H,1-3H3 |
| InChIKey | IIVBNXICDXKVBQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The IUPAC name of N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (CID 804168) is N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
What is the SMILES notation for N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The canonical SMILES for N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is Cc1nn(C)c(C)c1NS(=O)(=O)c1ccccc1.
What is the InChIKey of N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The InChIKey is IIVBNXICDXKVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-9-12(10(2)15(3)13-9)14-18(16,17)11-7-5-4-6-8-11/h4-8,14H,1-3H3.
What are the key properties of N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide has a molecular weight of 265.34 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is sourced from PubChem (CID 804168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).