About 1-acetyl-2,3-dihydroindole-5-sulfonamide
1-acetyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 804208) has the molecular formula C10H12N2O3S
and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-acetyl-2,3-dihydroindole-5-sulfonamide.
Molecular Properties
| Compound Name | 1-acetyl-2,3-dihydroindole-5-sulfonamide |
| PubChem CID | 804208 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-acetyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C10H12N2O3S/c1-7(13)12-5-4-8-6-9(16(11,14)15)2-3-10(8)12/h2-3,6H,4-5H2,1H3,(H2,11,14,15) |
| InChIKey | CIIBOYDDEVWHOY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-2,3-dihydroindole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2,3-dihydroindole-5-sulfonamide?
The IUPAC name of 1-acetyl-2,3-dihydroindole-5-sulfonamide (CID 804208) is 1-acetyl-2,3-dihydroindole-5-sulfonamide.
What is the SMILES notation for 1-acetyl-2,3-dihydroindole-5-sulfonamide?
The canonical SMILES for 1-acetyl-2,3-dihydroindole-5-sulfonamide is CC(=O)N1CCc2cc(S(N)(=O)=O)ccc21.
What is the InChIKey of 1-acetyl-2,3-dihydroindole-5-sulfonamide?
The InChIKey is CIIBOYDDEVWHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3S/c1-7(13)12-5-4-8-6-9(16(11,14)15)2-3-10(8)12/h2-3,6H,4-5H2,1H3,(H2,11,14,15).
What are the key properties of 1-acetyl-2,3-dihydroindole-5-sulfonamide?
1-acetyl-2,3-dihydroindole-5-sulfonamide has a molecular weight of 240.28 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2,3-dihydroindole-5-sulfonamide is sourced from PubChem (CID 804208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).