About [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate
[4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate (PubChem CID 804391) has the molecular formula C17H12N2O6
and a molecular weight of 340.29 g/mol. Its IUPAC name is [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate |
| PubChem CID | 804391 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C)cc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C17H12N2O6/c1-9-6-7-14(25-10(2)20)13(8-9)18-16(21)11-4-3-5-12(19(23)24)15(11)17(18)22/h3-8H,1-2H3 |
| InChIKey | IXGCHWFZAQTUAY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate?
The IUPAC name of [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate (CID 804391) is [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate.
What is the SMILES notation for [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate?
The canonical SMILES for [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate is CC(=O)Oc1ccc(C)cc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O.
What is the InChIKey of [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate?
The InChIKey is IXGCHWFZAQTUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O6/c1-9-6-7-14(25-10(2)20)13(8-9)18-16(21)11-4-3-5-12(19(23)24)15(11)17(18)22/h3-8H,1-2H3.
What are the key properties of [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate?
[4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate has a molecular weight of 340.29 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] acetate is sourced from PubChem (CID 804391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).