About 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole
1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole (PubChem CID 804692) has the molecular formula C11H10Cl2N2O2S
and a molecular weight of 305.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole |
| PubChem CID | 804692 |
| Molecular Formula | C11H10Cl2N2O2S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N2O2S/c1-7-6-8(2)15(14-7)18(16,17)10-5-3-4-9(12)11(10)13/h3-6H,1-2H3 |
| InChIKey | AYVICGQWQOBSKI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole?
The IUPAC name of 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole (CID 804692) is 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole.
What is the SMILES notation for 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole?
The canonical SMILES for 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole is Cc1cc(C)n(S(=O)(=O)c2cccc(Cl)c2Cl)n1.
What is the InChIKey of 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole?
The InChIKey is AYVICGQWQOBSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2O2S/c1-7-6-8(2)15(14-7)18(16,17)10-5-3-4-9(12)11(10)13/h3-6H,1-2H3.
What are the key properties of 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole?
1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole has a molecular weight of 305.19 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dichlorophenyl)sulfonyl-3,5-dimethylpyrazole is sourced from PubChem (CID 804692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).