About 1-but-3-ynyl-3,3-dimethylindol-2-one
1-but-3-ynyl-3,3-dimethylindol-2-one (PubChem CID 80500280) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-but-3-ynyl-3,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 1-but-3-ynyl-3,3-dimethylindol-2-one |
| PubChem CID | 80500280 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-but-3-ynyl-3,3-dimethylindol-2-one |
| SMILES | C#CCCN1C(=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H15NO/c1-4-5-10-15-12-9-7-6-8-11(12)14(2,3)13(15)16/h1,6-9H,5,10H2,2-3H3 |
| InChIKey | VVKYDTABGCULIT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-ynyl-3,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-ynyl-3,3-dimethylindol-2-one?
The IUPAC name of 1-but-3-ynyl-3,3-dimethylindol-2-one (CID 80500280) is 1-but-3-ynyl-3,3-dimethylindol-2-one.
What is the SMILES notation for 1-but-3-ynyl-3,3-dimethylindol-2-one?
The canonical SMILES for 1-but-3-ynyl-3,3-dimethylindol-2-one is C#CCCN1C(=O)C(C)(C)c2ccccc21.
What is the InChIKey of 1-but-3-ynyl-3,3-dimethylindol-2-one?
The InChIKey is VVKYDTABGCULIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-4-5-10-15-12-9-7-6-8-11(12)14(2,3)13(15)16/h1,6-9H,5,10H2,2-3H3.
What are the key properties of 1-but-3-ynyl-3,3-dimethylindol-2-one?
1-but-3-ynyl-3,3-dimethylindol-2-one has a molecular weight of 213.28 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-ynyl-3,3-dimethylindol-2-one is sourced from PubChem (CID 80500280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).