About 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid
2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 80500639) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 80500639 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C2CCCC2)NC(C(=O)O)CS1 |
| InChI | InChI=1S/C10H17NO2S/c1-10(7-4-2-3-5-7)11-8(6-14-10)9(12)13/h7-8,11H,2-6H2,1H3,(H,12,13) |
| InChIKey | QJHVQKCGXUMZNM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid (CID 80500639) is 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid is CC1(C2CCCC2)NC(C(=O)O)CS1.
What is the InChIKey of 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is QJHVQKCGXUMZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-10(7-4-2-3-5-7)11-8(6-14-10)9(12)13/h7-8,11H,2-6H2,1H3,(H,12,13).
What are the key properties of 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid?
2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 215.32 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-2-methyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 80500639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).