About 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane
3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane (PubChem CID 80500770) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane |
| PubChem CID | 80500770 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane |
| SMILES | CC(C)N1CCC2(C1)NC(C)(C)CS2 |
| InChI | InChI=1S/C11H22N2S/c1-9(2)13-6-5-11(7-13)12-10(3,4)8-14-11/h9,12H,5-8H2,1-4H3 |
| InChIKey | WOFGCDMWEBCVMR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane?
The IUPAC name of 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane (CID 80500770) is 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane?
The canonical SMILES for 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane is CC(C)N1CCC2(C1)NC(C)(C)CS2.
What is the InChIKey of 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane?
The InChIKey is WOFGCDMWEBCVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-9(2)13-6-5-11(7-13)12-10(3,4)8-14-11/h9,12H,5-8H2,1-4H3.
What are the key properties of 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane?
3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane has a molecular weight of 214.38 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-7-propan-2-yl-1-thia-4,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 80500770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).