C14H16N2O — CID 80501128
1-cyano-3-methyl-N-(2-methylphenyl)cyclobutane-1-carboxamide (PubChem CID 80501128) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-cyano-3-methyl-N-(2-methylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-3-methyl-N-(2-methylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80501128 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-cyano-3-methyl-N-(2-methylphenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1(C#N)CC(C)C1 |
| InChI | InChI=1S/C14H16N2O/c1-10-7-14(8-10,9-15)13(17)16-12-6-4-3-5-11(12)2/h3-6,10H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | JVXNYPNVQXBSRR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |