C15H14FN3O — CID 80501923
5,6-diethyl-3-(3-fluorophenoxy)pyridazine-4-carbonitrile (PubChem CID 80501923) has the molecular formula C15H14FN3O and a molecular weight of 271.29 g/mol. Its IUPAC name is 5,6-diethyl-3-(3-fluorophenoxy)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(3-fluorophenoxy)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80501923 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5,6-diethyl-3-(3-fluorophenoxy)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(Oc2cccc(F)c2)c(C#N)c1CC |
| InChI | InChI=1S/C15H14FN3O/c1-3-12-13(9-17)15(19-18-14(12)4-2)20-11-7-5-6-10(16)8-11/h5-8H,3-4H2,1-2H3 |
| InChIKey | XVUAKHIAVQANQI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |