About 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile
5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile (PubChem CID 80501948) has the molecular formula C13H14N4S2
and a molecular weight of 290.42 g/mol. Its IUPAC name is 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile |
| PubChem CID | 80501948 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(Sc2nc(C)cs2)c(C#N)c1CC |
| InChI | InChI=1S/C13H14N4S2/c1-4-9-10(6-14)12(17-16-11(9)5-2)19-13-15-8(3)7-18-13/h7H,4-5H2,1-3H3 |
| InChIKey | XTLLOSKMINNXMM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile?
The IUPAC name of 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile (CID 80501948) is 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile.
What is the SMILES notation for 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile?
The canonical SMILES for 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile is CCc1nnc(Sc2nc(C)cs2)c(C#N)c1CC.
What is the InChIKey of 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile?
The InChIKey is XTLLOSKMINNXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S2/c1-4-9-10(6-14)12(17-16-11(9)5-2)19-13-15-8(3)7-18-13/h7H,4-5H2,1-3H3.
What are the key properties of 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile?
5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile has a molecular weight of 290.42 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridazine-4-carbonitrile is sourced from PubChem (CID 80501948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).