About 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole
7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole (PubChem CID 80502935) has the molecular formula C10H11BrClN
and a molecular weight of 260.56 g/mol. Its IUPAC name is 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole |
| PubChem CID | 80502935 |
| Molecular Formula | C10H11BrClN |
| Molecular Weight | 260.56 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole |
| SMILES | CC1(C)CNc2c(Br)cc(Cl)cc21 |
| InChI | InChI=1S/C10H11BrClN/c1-10(2)5-13-9-7(10)3-6(12)4-8(9)11/h3-4,13H,5H2,1-2H3 |
| InChIKey | KCFCGFMPNCHZRL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole?
The IUPAC name of 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole (CID 80502935) is 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole.
What is the SMILES notation for 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole?
The canonical SMILES for 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole is CC1(C)CNc2c(Br)cc(Cl)cc21.
What is the InChIKey of 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole?
The InChIKey is KCFCGFMPNCHZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrClN/c1-10(2)5-13-9-7(10)3-6(12)4-8(9)11/h3-4,13H,5H2,1-2H3.
What are the key properties of 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole?
7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole has a molecular weight of 260.56 g/mol, XLogP of 3.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-chloro-3,3-dimethyl-1,2-dihydroindole is sourced from PubChem (CID 80502935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).