C10H13ClN2O — CID 80503191
2-amino-3-chloro-N-propylbenzamide (PubChem CID 80503191) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-amino-3-chloro-N-propylbenzamide.
| Compound Name | 2-amino-3-chloro-N-propylbenzamide |
|---|---|
| PubChem CID | 80503191 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-amino-3-chloro-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C10H13ClN2O/c1-2-6-13-10(14)7-4-3-5-8(11)9(7)12/h3-5H,2,6,12H2,1H3,(H,13,14) |
| InChIKey | AXXUDVMPKOIKLH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|