C15H23N3O3 — CID 80503310
2-amino-4-methoxy-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 80503310) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-amino-4-methoxy-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 80503310 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-amino-4-methoxy-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1ccc(C(=O)NCCCN2CCOCC2)c(N)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-20-12-3-4-13(14(16)11-12)15(19)17-5-2-6-18-7-9-21-10-8-18/h3-4,11H,2,5-10,16H2,1H3,(H,17,19) |
| InChIKey | ITTKLZNMPHLXBA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|