C11H16N2 — CID 80503717
3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine (PubChem CID 80503717) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | 3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 80503717 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine |
| SMILES | CC1(C)CNc2ccccc2NC1 |
| InChI | InChI=1S/C11H16N2/c1-11(2)7-12-9-5-3-4-6-10(9)13-8-11/h3-6,12-13H,7-8H2,1-2H3 |
| InChIKey | AGVGAAJKMNVTLM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|