4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid

C11H6F2N2O3 — CID 80503732

IUPAC4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(F)cc2F)nc(=O)[nH]1
InChIInChI=1S/C11H6F2N2O3/c12-5-1-2-6(7(13)3-5)8-4-9(10(16)17)15-11(18)14-8/h1-4H,(H,16,17)(H,14,15,18)
InChIKeyRZOKKQQVZPJVLY-UHFFFAOYSA-N
MW252.18 g/mol
LogP1.41
Rot. Bonds2

About 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid

4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 80503732) has the molecular formula C11H6F2N2O3 and a molecular weight of 252.18 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid.

Molecular Properties

Compound Name4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid
PubChem CID80503732
Molecular FormulaC11H6F2N2O3
Molecular Weight252.18 g/mol
Exact Mass252.03
IUPAC Name4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(F)cc2F)nc(=O)[nH]1
InChIInChI=1S/C11H6F2N2O3/c12-5-1-2-6(7(13)3-5)8-4-9(10(16)17)15-11(18)14-8/h1-4H,(H,16,17)(H,14,15,18)
InChIKeyRZOKKQQVZPJVLY-UHFFFAOYSA-N
XLogP1.41
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.18
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The IUPAC name of 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid (CID 80503732) is 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid.
What is the SMILES notation for 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The canonical SMILES for 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid is O=C(O)c1cc(-c2ccc(F)cc2F)nc(=O)[nH]1.
What is the InChIKey of 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The InChIKey is RZOKKQQVZPJVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O3/c12-5-1-2-6(7(13)3-5)8-4-9(10(16)17)15-11(18)14-8/h1-4H,(H,16,17)(H,14,15,18).
What are the key properties of 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid has a molecular weight of 252.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid is sourced from PubChem (CID 80503732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).