About [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone
[2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 80504283) has the molecular formula C12H22N6O
and a molecular weight of 266.35 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone |
| PubChem CID | 80504283 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CCCc1nc(C(=O)N2CCN(C)CC2CN)n[nH]1 |
| InChI | InChI=1S/C12H22N6O/c1-3-4-10-14-11(16-15-10)12(19)18-6-5-17(2)8-9(18)7-13/h9H,3-8,13H2,1-2H3,(H,14,15,16) |
| InChIKey | YBKLYPXZXDTQEC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone?
The IUPAC name of [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone (CID 80504283) is [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone.
What is the SMILES notation for [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone?
The canonical SMILES for [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone is CCCc1nc(C(=O)N2CCN(C)CC2CN)n[nH]1.
What is the InChIKey of [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone?
The InChIKey is YBKLYPXZXDTQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N6O/c1-3-4-10-14-11(16-15-10)12(19)18-6-5-17(2)8-9(18)7-13/h9H,3-8,13H2,1-2H3,(H,14,15,16).
What are the key properties of [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone?
[2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone has a molecular weight of 266.35 g/mol, XLogP of -0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-4-methylpiperazin-1-yl]-(5-propyl-1H-1,2,4-triazol-3-yl)methanone is sourced from PubChem (CID 80504283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).