C13H19ClFN3 — CID 80504679
[1-[(4-chloro-3-fluorophenyl)methyl]-4-methylpiperazin-2-yl]methanamine (PubChem CID 80504679) has the molecular formula C13H19ClFN3 and a molecular weight of 271.77 g/mol. Its IUPAC name is [1-[(4-chloro-3-fluorophenyl)methyl]-4-methylpiperazin-2-yl]methanamine.
| Compound Name | [1-[(4-chloro-3-fluorophenyl)methyl]-4-methylpiperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 80504679 |
| Molecular Formula | C13H19ClFN3 |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | [1-[(4-chloro-3-fluorophenyl)methyl]-4-methylpiperazin-2-yl]methanamine |
| SMILES | CN1CCN(Cc2ccc(Cl)c(F)c2)C(CN)C1 |
| InChI | InChI=1S/C13H19ClFN3/c1-17-4-5-18(11(7-16)9-17)8-10-2-3-12(14)13(15)6-10/h2-3,6,11H,4-5,7-9,16H2,1H3 |
| InChIKey | AQFFQEAXTXMCEL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |