About 1,6,8-trichloroisoquinoline
1,6,8-trichloroisoquinoline (PubChem CID 80505111) has the molecular formula C9H4Cl3N
and a molecular weight of 232.50 g/mol. Its IUPAC name is 1,6,8-trichloroisoquinoline.
Molecular Properties
| Compound Name | 1,6,8-trichloroisoquinoline |
| PubChem CID | 80505111 |
| Molecular Formula | C9H4Cl3N |
| Molecular Weight | 232.50 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 1,6,8-trichloroisoquinoline |
| SMILES | Clc1cc(Cl)c2c(Cl)nccc2c1 |
| InChI | InChI=1S/C9H4Cl3N/c10-6-3-5-1-2-13-9(12)8(5)7(11)4-6/h1-4H |
| InChIKey | WJFLFSUHDAEVQH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,6,8-trichloroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6,8-trichloroisoquinoline?
The IUPAC name of 1,6,8-trichloroisoquinoline (CID 80505111) is 1,6,8-trichloroisoquinoline.
What is the SMILES notation for 1,6,8-trichloroisoquinoline?
The canonical SMILES for 1,6,8-trichloroisoquinoline is Clc1cc(Cl)c2c(Cl)nccc2c1.
What is the InChIKey of 1,6,8-trichloroisoquinoline?
The InChIKey is WJFLFSUHDAEVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl3N/c10-6-3-5-1-2-13-9(12)8(5)7(11)4-6/h1-4H.
What are the key properties of 1,6,8-trichloroisoquinoline?
1,6,8-trichloroisoquinoline has a molecular weight of 232.50 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6,8-trichloroisoquinoline is sourced from PubChem (CID 80505111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).