C15H16BrN3O2 — CID 80505167
N'-(5-bromo-2-nitrophenyl)-1-phenylpropane-1,3-diamine (PubChem CID 80505167) has the molecular formula C15H16BrN3O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is N'-(5-bromo-2-nitrophenyl)-1-phenylpropane-1,3-diamine.
| Compound Name | N'-(5-bromo-2-nitrophenyl)-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 80505167 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N'-(5-bromo-2-nitrophenyl)-1-phenylpropane-1,3-diamine |
| SMILES | NC(CCNc1cc(Br)ccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H16BrN3O2/c16-12-6-7-15(19(20)21)14(10-12)18-9-8-13(17)11-4-2-1-3-5-11/h1-7,10,13,18H,8-9,17H2 |
| InChIKey | RYSNIAYWRXCQRX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|