About [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine (PubChem CID 80506443) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine.
Molecular Properties
| Compound Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine |
| PubChem CID | 80506443 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine |
| SMILES | Cc1nc(N2CCN(C)CC2CN)sc1C |
| InChI | InChI=1S/C11H20N4S/c1-8-9(2)16-11(13-8)15-5-4-14(3)7-10(15)6-12/h10H,4-7,12H2,1-3H3 |
| InChIKey | LRYIGTQKWOPYMZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine?
The IUPAC name of [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine (CID 80506443) is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine.
What is the SMILES notation for [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine?
The canonical SMILES for [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine is Cc1nc(N2CCN(C)CC2CN)sc1C.
What is the InChIKey of [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine?
The InChIKey is LRYIGTQKWOPYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S/c1-8-9(2)16-11(13-8)15-5-4-14(3)7-10(15)6-12/h10H,4-7,12H2,1-3H3.
What are the key properties of [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine?
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine has a molecular weight of 240.38 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpiperazin-2-yl]methanamine is sourced from PubChem (CID 80506443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).