C10H18N4 — CID 80507390
4-(aminomethyl)-N-methyl-N-(2-methylpropyl)pyridazin-3-amine (PubChem CID 80507390) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-N-(2-methylpropyl)pyridazin-3-amine.
| Compound Name | 4-(aminomethyl)-N-methyl-N-(2-methylpropyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 80507390 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-N-(2-methylpropyl)pyridazin-3-amine |
| SMILES | CC(C)CN(C)c1nnccc1CN |
| InChI | InChI=1S/C10H18N4/c1-8(2)7-14(3)10-9(6-11)4-5-12-13-10/h4-5,8H,6-7,11H2,1-3H3 |
| InChIKey | UTGSHEOXPBETNW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |