C15H20N2O2 — CID 80507605
1-(3-amino-3-phenylpropyl)azepane-2,7-dione (PubChem CID 80507605) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(3-amino-3-phenylpropyl)azepane-2,7-dione.
| Compound Name | 1-(3-amino-3-phenylpropyl)azepane-2,7-dione |
|---|---|
| PubChem CID | 80507605 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-(3-amino-3-phenylpropyl)azepane-2,7-dione |
| SMILES | NC(CCN1C(=O)CCCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c16-13(12-6-2-1-3-7-12)10-11-17-14(18)8-4-5-9-15(17)19/h1-3,6-7,13H,4-5,8-11,16H2 |
| InChIKey | JQQHIMAUYKHBHE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|