About 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol
2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol (PubChem CID 80507766) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol |
| PubChem CID | 80507766 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol |
| SMILES | CCc1nnc(OCCO)c(CN)c1CC |
| InChI | InChI=1S/C11H19N3O2/c1-3-8-9(7-12)11(16-6-5-15)14-13-10(8)4-2/h15H,3-7,12H2,1-2H3 |
| InChIKey | IIKRJLMNPXELPE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol?
The IUPAC name of 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol (CID 80507766) is 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol.
What is the SMILES notation for 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol?
The canonical SMILES for 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol is CCc1nnc(OCCO)c(CN)c1CC.
What is the InChIKey of 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol?
The InChIKey is IIKRJLMNPXELPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-3-8-9(7-12)11(16-6-5-15)14-13-10(8)4-2/h15H,3-7,12H2,1-2H3.
What are the key properties of 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol?
2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol has a molecular weight of 225.29 g/mol, XLogP of 0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]oxyethanol is sourced from PubChem (CID 80507766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).