About 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid
3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid (PubChem CID 80508108) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid |
| PubChem CID | 80508108 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CCc1nnc(NC2(C(=O)O)CCOC2)c(C#N)c1CC |
| InChI | InChI=1S/C14H18N4O3/c1-3-9-10(7-15)12(18-17-11(9)4-2)16-14(13(19)20)5-6-21-8-14/h3-6,8H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | CKLSNFGPOJZKHL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid?
The IUPAC name of 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid (CID 80508108) is 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid?
The canonical SMILES for 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid is CCc1nnc(NC2(C(=O)O)CCOC2)c(C#N)c1CC.
What is the InChIKey of 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid?
The InChIKey is CKLSNFGPOJZKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c1-3-9-10(7-15)12(18-17-11(9)4-2)16-14(13(19)20)5-6-21-8-14/h3-6,8H2,1-2H3,(H,16,18)(H,19,20).
What are the key properties of 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid?
3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid has a molecular weight of 290.32 g/mol, XLogP of 1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 80508108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).