About 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide
2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide (PubChem CID 80508158) has the molecular formula C15H27N5O
and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide |
| PubChem CID | 80508158 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1nnc(CC)c(CC)c1CN |
| InChI | InChI=1S/C15H27N5O/c1-5-11-12(9-16)15(19-18-13(11)6-2)20(8-4)10-14(21)17-7-3/h5-10,16H2,1-4H3,(H,17,21) |
| InChIKey | XCEWFCVMCVSNGW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide?
The IUPAC name of 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide (CID 80508158) is 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide.
What is the SMILES notation for 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide?
The canonical SMILES for 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide is CCNC(=O)CN(CC)c1nnc(CC)c(CC)c1CN.
What is the InChIKey of 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide?
The InChIKey is XCEWFCVMCVSNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N5O/c1-5-11-12(9-16)15(19-18-13(11)6-2)20(8-4)10-14(21)17-7-3/h5-10,16H2,1-4H3,(H,17,21).
What are the key properties of 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide?
2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide has a molecular weight of 293.42 g/mol, XLogP of 1.02, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(aminomethyl)-5,6-diethylpyridazin-3-yl]-ethylamino]-N-ethylacetamide is sourced from PubChem (CID 80508158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).