About 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide
4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 805087) has the molecular formula C15H10ClN3O2
and a molecular weight of 299.72 g/mol. Its IUPAC name is 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
| PubChem CID | 805087 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-12-8-6-10(7-9-12)13(20)17-15-19-18-14(21-15)11-4-2-1-3-5-11/h1-9H,(H,17,19,20) |
| InChIKey | YZLBFDGNVDNPIB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The IUPAC name of 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide (CID 805087) is 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The canonical SMILES for 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide is O=C(Nc1nnc(-c2ccccc2)o1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The InChIKey is YZLBFDGNVDNPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3O2/c16-12-8-6-10(7-9-12)13(20)17-15-19-18-14(21-15)11-4-2-1-3-5-11/h1-9H,(H,17,19,20).
What are the key properties of 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide has a molecular weight of 299.72 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide is sourced from PubChem (CID 805087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).