About 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile
3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 80508707) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile |
| PubChem CID | 80508707 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NC(C)CC)c(C#N)c1CC |
| InChI | InChI=1S/C13H20N4/c1-5-9(4)15-13-11(8-14)10(6-2)12(7-3)16-17-13/h9H,5-7H2,1-4H3,(H,15,17) |
| InChIKey | MGNKCCJBNRDCOB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile?
The IUPAC name of 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile (CID 80508707) is 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile.
What is the SMILES notation for 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile?
The canonical SMILES for 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile is CCc1nnc(NC(C)CC)c(C#N)c1CC.
What is the InChIKey of 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile?
The InChIKey is MGNKCCJBNRDCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-5-9(4)15-13-11(8-14)10(6-2)12(7-3)16-17-13/h9H,5-7H2,1-4H3,(H,15,17).
What are the key properties of 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile?
3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile has a molecular weight of 232.33 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butan-2-ylamino)-5,6-diethylpyridazine-4-carbonitrile is sourced from PubChem (CID 80508707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).