About N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine
N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 80508850) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 80508850 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nnccc1CN |
| InChI | InChI=1S/C9H17N5/c1-14(2)6-5-11-9-8(7-10)3-4-12-13-9/h3-4H,5-7,10H2,1-2H3,(H,11,13) |
| InChIKey | UYIBTJOBGHEBFD-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine (CID 80508850) is N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine is CN(C)CCNc1nnccc1CN.
What is the InChIKey of N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine?
The InChIKey is UYIBTJOBGHEBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c1-14(2)6-5-11-9-8(7-10)3-4-12-13-9/h3-4H,5-7,10H2,1-2H3,(H,11,13).
What are the key properties of N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine?
N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine has a molecular weight of 195.27 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(aminomethyl)pyridazin-3-yl]-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 80508850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).