C11H19N5O — CID 80508966
2-[[4-(aminomethyl)pyridazin-3-yl]-butylamino]acetamide (PubChem CID 80508966) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)pyridazin-3-yl]-butylamino]acetamide.
| Compound Name | 2-[[4-(aminomethyl)pyridazin-3-yl]-butylamino]acetamide |
|---|---|
| PubChem CID | 80508966 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[[4-(aminomethyl)pyridazin-3-yl]-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1nnccc1CN |
| InChI | InChI=1S/C11H19N5O/c1-2-3-6-16(8-10(13)17)11-9(7-12)4-5-14-15-11/h4-5H,2-3,6-8,12H2,1H3,(H2,13,17) |
| InChIKey | PCTAWFISGDEWHO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |