C15H24N4 — CID 80509404
5,6-diethyl-3-[methyl(pentyl)amino]pyridazine-4-carbonitrile (PubChem CID 80509404) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5,6-diethyl-3-[methyl(pentyl)amino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-[methyl(pentyl)amino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509404 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 5,6-diethyl-3-[methyl(pentyl)amino]pyridazine-4-carbonitrile |
| SMILES | CCCCCN(C)c1nnc(CC)c(CC)c1C#N |
| InChI | InChI=1S/C15H24N4/c1-5-8-9-10-19(4)15-13(11-16)12(6-2)14(7-3)17-18-15/h5-10H2,1-4H3 |
| InChIKey | KXVOAEWHKPQVAP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|