C9H10N4O — CID 80509512
3-(3-hydroxypyrrolidin-1-yl)pyridazine-4-carbonitrile (PubChem CID 80509512) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-(3-hydroxypyrrolidin-1-yl)pyridazine-4-carbonitrile.
| Compound Name | 3-(3-hydroxypyrrolidin-1-yl)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509512 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-(3-hydroxypyrrolidin-1-yl)pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1N1CCC(O)C1 |
| InChI | InChI=1S/C9H10N4O/c10-5-7-1-3-11-12-9(7)13-4-2-8(14)6-13/h1,3,8,14H,2,4,6H2 |
| InChIKey | DZUCUWJBGYREQR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |