About 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide
1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide (PubChem CID 80509976) has the molecular formula C13H14N6O
and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide |
| PubChem CID | 80509976 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide |
| SMILES | CCc1nnc(-n2cc(C(N)=O)cn2)c(C#N)c1CC |
| InChI | InChI=1S/C13H14N6O/c1-3-9-10(5-14)13(18-17-11(9)4-2)19-7-8(6-16-19)12(15)20/h6-7H,3-4H2,1-2H3,(H2,15,20) |
| InChIKey | XBGNXVPXGAODEK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide?
The IUPAC name of 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide (CID 80509976) is 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide?
The canonical SMILES for 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide is CCc1nnc(-n2cc(C(N)=O)cn2)c(C#N)c1CC.
What is the InChIKey of 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide?
The InChIKey is XBGNXVPXGAODEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N6O/c1-3-9-10(5-14)13(18-17-11(9)4-2)19-7-8(6-16-19)12(15)20/h6-7H,3-4H2,1-2H3,(H2,15,20).
What are the key properties of 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide?
1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide has a molecular weight of 270.30 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyano-5,6-diethylpyridazin-3-yl)pyrazole-4-carboxamide is sourced from PubChem (CID 80509976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).