About 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile
3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile (PubChem CID 80510034) has the molecular formula C9H9F3N4
and a molecular weight of 230.19 g/mol. Its IUPAC name is 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile |
| PubChem CID | 80510034 |
| Molecular Formula | C9H9F3N4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile |
| SMILES | CN(CCC(F)(F)F)c1nnccc1C#N |
| InChI | InChI=1S/C9H9F3N4/c1-16(5-3-9(10,11)12)8-7(6-13)2-4-14-15-8/h2,4H,3,5H2,1H3 |
| InChIKey | INIBMPWBORULFM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile?
The IUPAC name of 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile (CID 80510034) is 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile.
What is the SMILES notation for 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile?
The canonical SMILES for 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile is CN(CCC(F)(F)F)c1nnccc1C#N.
What is the InChIKey of 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile?
The InChIKey is INIBMPWBORULFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N4/c1-16(5-3-9(10,11)12)8-7(6-13)2-4-14-15-8/h2,4H,3,5H2,1H3.
What are the key properties of 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile?
3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile has a molecular weight of 230.19 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbonitrile is sourced from PubChem (CID 80510034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).