About 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile
3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 80510131) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile |
| PubChem CID | 80510131 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(N2CC(=O)NC(=O)C2)c(C#N)c1CC |
| InChI | InChI=1S/C13H15N5O2/c1-3-8-9(5-14)13(17-16-10(8)4-2)18-6-11(19)15-12(20)7-18/h3-4,6-7H2,1-2H3,(H,15,19,20) |
| InChIKey | DTDJZBWBLBONGZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile?
The IUPAC name of 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile (CID 80510131) is 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile.
What is the SMILES notation for 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile?
The canonical SMILES for 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile is CCc1nnc(N2CC(=O)NC(=O)C2)c(C#N)c1CC.
What is the InChIKey of 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile?
The InChIKey is DTDJZBWBLBONGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-3-8-9(5-14)13(17-16-10(8)4-2)18-6-11(19)15-12(20)7-18/h3-4,6-7H2,1-2H3,(H,15,19,20).
What are the key properties of 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile?
3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile has a molecular weight of 273.30 g/mol, XLogP of -0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dioxopiperazin-1-yl)-5,6-diethylpyridazine-4-carbonitrile is sourced from PubChem (CID 80510131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).