About 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile
3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile (PubChem CID 80510270) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile |
| PubChem CID | 80510270 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile |
| SMILES | CN(Cc1cscn1)c1nnccc1C#N |
| InChI | InChI=1S/C10H9N5S/c1-15(5-9-6-16-7-12-9)10-8(4-11)2-3-13-14-10/h2-3,6-7H,5H2,1H3 |
| InChIKey | RSZZKOGTRHDRHU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile?
The IUPAC name of 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile (CID 80510270) is 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile.
What is the SMILES notation for 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile?
The canonical SMILES for 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile is CN(Cc1cscn1)c1nnccc1C#N.
What is the InChIKey of 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile?
The InChIKey is RSZZKOGTRHDRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c1-15(5-9-6-16-7-12-9)10-8(4-11)2-3-13-14-10/h2-3,6-7H,5H2,1H3.
What are the key properties of 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile?
3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile has a molecular weight of 231.28 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridazine-4-carbonitrile is sourced from PubChem (CID 80510270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).