About 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide
3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide (PubChem CID 80511482) has the molecular formula C9H11F3N4OS
and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide |
| PubChem CID | 80511482 |
| Molecular Formula | C9H11F3N4OS |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N4OS/c10-9(11,12)5-17-4-3-14-8-6(7(13)18)1-2-15-16-8/h1-2H,3-5H2,(H2,13,18)(H,14,16) |
| InChIKey | VBIXJEVTTJMFLD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide?
The IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide (CID 80511482) is 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide.
What is the SMILES notation for 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide?
The canonical SMILES for 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide is NC(=S)c1ccnnc1NCCOCC(F)(F)F.
What is the InChIKey of 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide?
The InChIKey is VBIXJEVTTJMFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N4OS/c10-9(11,12)5-17-4-3-14-8-6(7(13)18)1-2-15-16-8/h1-2H,3-5H2,(H2,13,18)(H,14,16).
What are the key properties of 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide?
3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide has a molecular weight of 280.27 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazine-4-carbothioamide is sourced from PubChem (CID 80511482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).