C13H19F3N4S — CID 80511683
5,6-diethyl-3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbothioamide (PubChem CID 80511683) has the molecular formula C13H19F3N4S and a molecular weight of 320.38 g/mol. Its IUPAC name is 5,6-diethyl-3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511683 |
| Molecular Formula | C13H19F3N4S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 5,6-diethyl-3-[methyl(3,3,3-trifluoropropyl)amino]pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(N(C)CCC(F)(F)F)c(C(N)=S)c1CC |
| InChI | InChI=1S/C13H19F3N4S/c1-4-8-9(5-2)18-19-12(10(8)11(17)21)20(3)7-6-13(14,15)16/h4-7H2,1-3H3,(H2,17,21) |
| InChIKey | JYDJHHWPIYAYMI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|