C8H9F3N4S — CID 80511907
3-(3,3,3-trifluoropropylamino)pyridazine-4-carbothioamide (PubChem CID 80511907) has the molecular formula C8H9F3N4S and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropylamino)pyridazine-4-carbothioamide.
| Compound Name | 3-(3,3,3-trifluoropropylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511907 |
| Molecular Formula | C8H9F3N4S |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-(3,3,3-trifluoropropylamino)pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCCC(F)(F)F |
| InChI | InChI=1S/C8H9F3N4S/c9-8(10,11)2-4-13-7-5(6(12)16)1-3-14-15-7/h1,3H,2,4H2,(H2,12,16)(H,13,15) |
| InChIKey | UDHDIVMWAMUMGR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|