C12H17F3N4S — CID 80512201
5,6-diethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide (PubChem CID 80512201) has the molecular formula C12H17F3N4S and a molecular weight of 306.36 g/mol. Its IUPAC name is 5,6-diethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80512201 |
| Molecular Formula | C12H17F3N4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 5,6-diethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(N(C)CC(F)(F)F)c(C(N)=S)c1CC |
| InChI | InChI=1S/C12H17F3N4S/c1-4-7-8(5-2)17-18-11(9(7)10(16)20)19(3)6-12(13,14)15/h4-6H2,1-3H3,(H2,16,20) |
| InChIKey | VVSCOJSFUAFZCQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|