About 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid
2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid (PubChem CID 80512525) has the molecular formula C10H9N7O2S
and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid |
| PubChem CID | 80512525 |
| Molecular Formula | C10H9N7O2S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid |
| SMILES | Cc1nnc(Sc2nnnn2CC(=O)O)c(C#N)c1C |
| InChI | InChI=1S/C10H9N7O2S/c1-5-6(2)12-13-9(7(5)3-11)20-10-14-15-16-17(10)4-8(18)19/h4H2,1-2H3,(H,18,19) |
| InChIKey | MJTGWTQNYWJMHB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid?
The IUPAC name of 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid (CID 80512525) is 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid.
What is the SMILES notation for 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid?
The canonical SMILES for 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid is Cc1nnc(Sc2nnnn2CC(=O)O)c(C#N)c1C.
What is the InChIKey of 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid?
The InChIKey is MJTGWTQNYWJMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N7O2S/c1-5-6(2)12-13-9(7(5)3-11)20-10-14-15-16-17(10)4-8(18)19/h4H2,1-2H3,(H,18,19).
What are the key properties of 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid?
2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid has a molecular weight of 291.30 g/mol, XLogP of 0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-cyano-5,6-dimethylpyridazin-3-yl)sulfanyltetrazol-1-yl]acetic acid is sourced from PubChem (CID 80512525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).