C8H13N5 — CID 80513462
3-(propylamino)pyridazine-4-carboximidamide (PubChem CID 80513462) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 3-(propylamino)pyridazine-4-carboximidamide.
| Compound Name | 3-(propylamino)pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513462 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 3-(propylamino)pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnnc1NCCC |
| InChI | InChI=1S/C8H13N5/c1-2-4-11-8-6(7(9)10)3-5-12-13-8/h3,5H,2,4H2,1H3,(H3,9,10)(H,11,13) |
| InChIKey | CQWKWMLXIBBTHL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|