About (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine
(3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine (PubChem CID 80514524) has the molecular formula C13H23N3S
and a molecular weight of 253.41 g/mol. Its IUPAC name is (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine |
| PubChem CID | 80514524 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine |
| SMILES | CCCCSc1nnc(CC)c(CC)c1CN |
| InChI | InChI=1S/C13H23N3S/c1-4-7-8-17-13-11(9-14)10(5-2)12(6-3)15-16-13/h4-9,14H2,1-3H3 |
| InChIKey | YLHBBZCLOJHPED-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine?
The IUPAC name of (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine (CID 80514524) is (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine.
What is the SMILES notation for (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine?
The canonical SMILES for (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine is CCCCSc1nnc(CC)c(CC)c1CN.
What is the InChIKey of (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine?
The InChIKey is YLHBBZCLOJHPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3S/c1-4-7-8-17-13-11(9-14)10(5-2)12(6-3)15-16-13/h4-9,14H2,1-3H3.
What are the key properties of (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine?
(3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine has a molecular weight of 253.41 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butylsulfanyl-5,6-diethylpyridazin-4-yl)methanamine is sourced from PubChem (CID 80514524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).