About [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine
[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine (PubChem CID 80514737) has the molecular formula C8H10N6S
and a molecular weight of 222.28 g/mol. Its IUPAC name is [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine.
Molecular Properties
| Compound Name | [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine |
| PubChem CID | 80514737 |
| Molecular Formula | C8H10N6S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine |
| SMILES | Cn1cnnc1Sc1nnccc1CN |
| InChI | InChI=1S/C8H10N6S/c1-14-5-11-13-8(14)15-7-6(4-9)2-3-10-12-7/h2-3,5H,4,9H2,1H3 |
| InChIKey | FNIDWBKHOXYYBX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine?
The IUPAC name of [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine (CID 80514737) is [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine.
What is the SMILES notation for [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine?
The canonical SMILES for [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine is Cn1cnnc1Sc1nnccc1CN.
What is the InChIKey of [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine?
The InChIKey is FNIDWBKHOXYYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6S/c1-14-5-11-13-8(14)15-7-6(4-9)2-3-10-12-7/h2-3,5H,4,9H2,1H3.
What are the key properties of [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine?
[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine has a molecular weight of 222.28 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazin-4-yl]methanamine is sourced from PubChem (CID 80514737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).