About 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid
2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80516543) has the molecular formula C11H19N5O4S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid |
| PubChem CID | 80516543 |
| Molecular Formula | C11H19N5O4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid |
| SMILES | CCCn1nnnc1CN1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C11H19N5O4S/c1-2-3-16-10(12-13-14-16)7-15-4-5-21(19,20)8-9(15)6-11(17)18/h9H,2-8H2,1H3,(H,17,18) |
| InChIKey | WNPUIGIXGXIFRF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid?
The IUPAC name of 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid (CID 80516543) is 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid.
What is the SMILES notation for 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid?
The canonical SMILES for 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid is CCCn1nnnc1CN1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid?
The InChIKey is WNPUIGIXGXIFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O4S/c1-2-3-16-10(12-13-14-16)7-15-4-5-21(19,20)8-9(15)6-11(17)18/h9H,2-8H2,1H3,(H,17,18).
What are the key properties of 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid?
2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid has a molecular weight of 317.37 g/mol, XLogP of -0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1-dioxo-4-[(1-propyltetrazol-5-yl)methyl]-1,4-thiazinan-3-yl]acetic acid is sourced from PubChem (CID 80516543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).