About 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid
2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80516701) has the molecular formula C10H17NO8S2
and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| PubChem CID | 80516701 |
| Molecular Formula | C10H17NO8S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | COC(=O)CCS(=O)(=O)N1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C10H17NO8S2/c1-19-10(14)2-4-21(17,18)11-3-5-20(15,16)7-8(11)6-9(12)13/h8H,2-7H2,1H3,(H,12,13) |
| InChIKey | GPWSZLRMHARADW-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The IUPAC name of 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (CID 80516701) is 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The canonical SMILES for 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid is COC(=O)CCS(=O)(=O)N1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The InChIKey is GPWSZLRMHARADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO8S2/c1-19-10(14)2-4-21(17,18)11-3-5-20(15,16)7-8(11)6-9(12)13/h8H,2-7H2,1H3,(H,12,13).
What are the key properties of 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid has a molecular weight of 343.38 g/mol, XLogP of -1.55, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-methoxy-3-oxopropyl)sulfonyl-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid is sourced from PubChem (CID 80516701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).