C11H12F3N3O2 — CID 80517006
3-[3-(trifluoromethyl)piperidin-1-yl]pyridazine-4-carboxylic acid (PubChem CID 80517006) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)piperidin-1-yl]pyridazine-4-carboxylic acid.
| Compound Name | 3-[3-(trifluoromethyl)piperidin-1-yl]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80517006 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[3-(trifluoromethyl)piperidin-1-yl]pyridazine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnnc1N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)7-2-1-5-17(6-7)9-8(10(18)19)3-4-15-16-9/h3-4,7H,1-2,5-6H2,(H,18,19) |
| InChIKey | NZZQKCOSYZJLKP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |